Polymyxin B Sulfate
Cat# orb1309774-200mg
Size : 200mg
Brand : Biorbyt
Polymyxin B Sulfate
Catalog Number: orb1309774
| Catalog Number | orb1309774 |
|---|---|
| Category | Small Molecules |
| Description | Polymyxin B Sulfate |
| CAS Number | 1405-20-5 |
| Purity | 98% |
| MW | 1301.56 |
| SMILES | OS(O)(=O)=O.CCC(C)CCCCC(=O)N[C@@H](CCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@@H](NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](CCN)NC1=O)[C@@H](C)O |
| Formula | C56H100N16O17S |
| Biological Activity | Polymyxin B Sulfate (Poly-RX) is a mixture of polymyxins B1 and B2, obtained from Bacillus polymyxa strains. They are basic polypeptides of about eight amino acids and have cationic detergent action on cell membranes. Polymyxin B Sulfate (Poly-RX) is used for infections with gram-negative organisms, but may be neurotoxic and nephrotoxic. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |